C19H23F2NO4 — CID 169091022
ethyl 3-cyano-5-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pentanoate (PubChem CID 169091022) has the molecular formula C19H23F2NO4 and a molecular weight of 367.39 g/mol. Its IUPAC name is ethyl 3-cyano-5-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pentanoate.
| Compound Name | ethyl 3-cyano-5-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pentanoate |
|---|---|
| PubChem CID | 169091022 |
| Molecular Formula | C19H23F2NO4 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethyl 3-cyano-5-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]pentanoate |
| SMILES | CCOC(=O)CC(C#N)CCc1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C19H23F2NO4/c1-2-24-18(23)10-15(11-22)6-3-13-7-8-16(26-19(20)21)17(9-13)25-12-14-4-5-14/h7-9,14-15,19H,2-6,10,12H2,1H3 |
| InChIKey | BJQBEKNUCLBMAV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |