C17H23BrO3 — CID 22559143
ethyl 3-[3-bromo-4-(cyclopentylmethoxy)phenyl]propanoate (PubChem CID 22559143) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is ethyl 3-[3-bromo-4-(cyclopentylmethoxy)phenyl]propanoate.
| Compound Name | ethyl 3-[3-bromo-4-(cyclopentylmethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 22559143 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | ethyl 3-[3-bromo-4-(cyclopentylmethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(OCC2CCCC2)c(Br)c1 |
| InChI | InChI=1S/C17H23BrO3/c1-2-20-17(19)10-8-13-7-9-16(15(18)11-13)21-12-14-5-3-4-6-14/h7,9,11,14H,2-6,8,10,12H2,1H3 |
| InChIKey | SEXMYPFCQHQBLN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |