C15H15F2NO3 — CID 141172015
2-[3-(cyclobutylmethoxy)-4-(difluoromethoxy)phenyl]-1,3-oxazole (PubChem CID 141172015) has the molecular formula C15H15F2NO3 and a molecular weight of 295.28 g/mol. Its IUPAC name is 2-[3-(cyclobutylmethoxy)-4-(difluoromethoxy)phenyl]-1,3-oxazole.
| Compound Name | 2-[3-(cyclobutylmethoxy)-4-(difluoromethoxy)phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 141172015 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[3-(cyclobutylmethoxy)-4-(difluoromethoxy)phenyl]-1,3-oxazole |
| SMILES | FC(F)Oc1ccc(-c2ncco2)cc1OCC1CCC1 |
| InChI | InChI=1S/C15H15F2NO3/c16-15(17)21-12-5-4-11(14-18-6-7-19-14)8-13(12)20-9-10-2-1-3-10/h4-8,10,15H,1-3,9H2 |
| InChIKey | ZFTIRLXCGHAUKS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |