C22H20F2O3 — CID 175575581
7-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]ethenyl]-2,3-dihydroinden-1-one (PubChem CID 175575581) has the molecular formula C22H20F2O3 and a molecular weight of 370.39 g/mol. Its IUPAC name is 7-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]ethenyl]-2,3-dihydroinden-1-one.
| Compound Name | 7-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]ethenyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 175575581 |
| Molecular Formula | C22H20F2O3 |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 7-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]ethenyl]-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cccc(C=Cc3ccc(OC(F)F)c(OCC4CC4)c3)c21 |
| InChI | InChI=1S/C22H20F2O3/c23-22(24)27-19-11-7-14(12-20(19)26-13-15-4-5-15)6-8-16-2-1-3-17-9-10-18(25)21(16)17/h1-3,6-8,11-12,15,22H,4-5,9-10,13H2 |
| InChIKey | KDKZURFJWXXPIZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|