C11H5Cl2F3NO2- — CID 131741388
3-cyano-3-(3,5-dichlorophenyl)-4,4,4-trifluorobutanoate (PubChem CID 131741388) has the molecular formula C11H5Cl2F3NO2- and a molecular weight of 311.07 g/mol. Its IUPAC name is 3-cyano-3-(3,5-dichlorophenyl)-4,4,4-trifluorobutanoate.
| Compound Name | 3-cyano-3-(3,5-dichlorophenyl)-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 131741388 |
| Molecular Formula | C11H5Cl2F3NO2- |
| Molecular Weight | 311.07 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 3-cyano-3-(3,5-dichlorophenyl)-4,4,4-trifluorobutanoate |
| SMILES | N#CC(CC(=O)[O-])(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H6Cl2F3NO2/c12-7-1-6(2-8(13)3-7)10(5-17,4-9(18)19)11(14,15)16/h1-3H,4H2,(H,18,19)/p-1 |
| InChIKey | LTGRGWZJZVMPTH-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.07 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |