5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid

C14H11Cl2F3O2 — CID 90342672

IUPAC5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid
SMILESC#CC(CCCC(=O)O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F
InChIInChI=1S/C14H11Cl2F3O2/c1-2-13(14(17,18)19,5-3-4-12(20)21)9-6-10(15)8-11(16)7-9/h1,6-8H,3-5H2,(H,20,21)
InChIKeyDVXSIIRXPDPMTR-UHFFFAOYSA-N
MW339.14 g/mol
LogP4.68
Rot. Bonds5

About 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid

5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid (PubChem CID 90342672) has the molecular formula C14H11Cl2F3O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid.

Molecular Properties

Compound Name5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid
PubChem CID90342672
Molecular FormulaC14H11Cl2F3O2
Molecular Weight339.14 g/mol
Exact Mass338.01
IUPAC Name5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid
SMILESC#CC(CCCC(=O)O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F
InChIInChI=1S/C14H11Cl2F3O2/c1-2-13(14(17,18)19,5-3-4-12(20)21)9-6-10(15)8-11(16)7-9/h1,6-8H,3-5H2,(H,20,21)
InChIKeyDVXSIIRXPDPMTR-UHFFFAOYSA-N
XLogP4.68
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.14
LogP ≤ 54.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid?
The IUPAC name of 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid (CID 90342672) is 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid?
The canonical SMILES for 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid is C#CC(CCCC(=O)O)(c1cc(Cl)cc(Cl)c1)C(F)(F)F.
What is the InChIKey of 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid?
The InChIKey is DVXSIIRXPDPMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2F3O2/c1-2-13(14(17,18)19,5-3-4-12(20)21)9-6-10(15)8-11(16)7-9/h1,6-8H,3-5H2,(H,20,21).
What are the key properties of 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid?
5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid has a molecular weight of 339.14 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-5-(trifluoromethyl)hept-6-ynoic acid is sourced from PubChem (CID 90342672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).