C19H22F10O4S — CID 140904191
5-(2,5-ditert-butylphenoxy)-1,1,2,2,3,3,4,4,5,5-decafluoropentane-1-sulfonic acid (PubChem CID 140904191) has the molecular formula C19H22F10O4S and a molecular weight of 536.43 g/mol. Its IUPAC name is 5-(2,5-ditert-butylphenoxy)-1,1,2,2,3,3,4,4,5,5-decafluoropentane-1-sulfonic acid.
| Compound Name | 5-(2,5-ditert-butylphenoxy)-1,1,2,2,3,3,4,4,5,5-decafluoropentane-1-sulfonic acid |
|---|---|
| PubChem CID | 140904191 |
| Molecular Formula | C19H22F10O4S |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 5-(2,5-ditert-butylphenoxy)-1,1,2,2,3,3,4,4,5,5-decafluoropentane-1-sulfonic acid |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)c1 |
| InChI | InChI=1S/C19H22F10O4S/c1-13(2,3)10-7-8-11(14(4,5)6)12(9-10)33-18(26,27)16(22,23)15(20,21)17(24,25)19(28,29)34(30,31)32/h7-9H,1-6H3,(H,30,31,32) |
| InChIKey | YSIJTUKVRBRIPD-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|