C21H31F7O3S2 — CID 173109288
1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid;2,3,4-tritert-butylbenzenethiol (PubChem CID 173109288) has the molecular formula C21H31F7O3S2 and a molecular weight of 528.60 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid;2,3,4-tritert-butylbenzenethiol.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid;2,3,4-tritert-butylbenzenethiol |
|---|---|
| PubChem CID | 173109288 |
| Molecular Formula | C21H31F7O3S2 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonic acid;2,3,4-tritert-butylbenzenethiol |
| SMILES | CC(C)(C)c1ccc(S)c(C(C)(C)C)c1C(C)(C)C.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H30S.C3HF7O3S/c1-16(2,3)12-10-11-13(19)15(18(7,8)9)14(12)17(4,5)6;4-1(5,2(6,7)8)3(9,10)14(11,12)13/h10-11,19H,1-9H3;(H,11,12,13) |
| InChIKey | RTYISIDIJYHODL-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|