C17H21F5O6S2 — CID 123716217
1-O-(4-cyclohexylphenyl) 3-O-methyl 1,1,2,2,3-pentafluorobutane-1,3-disulfonate (PubChem CID 123716217) has the molecular formula C17H21F5O6S2 and a molecular weight of 480.47 g/mol. Its IUPAC name is 1-O-(4-cyclohexylphenyl) 3-O-methyl 1,1,2,2,3-pentafluorobutane-1,3-disulfonate.
| Compound Name | 1-O-(4-cyclohexylphenyl) 3-O-methyl 1,1,2,2,3-pentafluorobutane-1,3-disulfonate |
|---|---|
| PubChem CID | 123716217 |
| Molecular Formula | C17H21F5O6S2 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-O-(4-cyclohexylphenyl) 3-O-methyl 1,1,2,2,3-pentafluorobutane-1,3-disulfonate |
| SMILES | COS(=O)(=O)C(C)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H21F5O6S2/c1-15(18,29(23,24)27-2)16(19,20)17(21,22)30(25,26)28-14-10-8-13(9-11-14)12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3 |
| InChIKey | WKNWXZXELVNREJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|