C16H20F5O2PS2 — CID 144560831
[1-(4-cyclohexylphenoxy)sulfanyl-1,1,2,3,3-pentafluoro-3-methoxysulfanylpropan-2-yl]phosphane (PubChem CID 144560831) has the molecular formula C16H20F5O2PS2 and a molecular weight of 434.43 g/mol. Its IUPAC name is [1-(4-cyclohexylphenoxy)sulfanyl-1,1,2,3,3-pentafluoro-3-methoxysulfanylpropan-2-yl]phosphane.
| Compound Name | [1-(4-cyclohexylphenoxy)sulfanyl-1,1,2,3,3-pentafluoro-3-methoxysulfanylpropan-2-yl]phosphane |
|---|---|
| PubChem CID | 144560831 |
| Molecular Formula | C16H20F5O2PS2 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [1-(4-cyclohexylphenoxy)sulfanyl-1,1,2,3,3-pentafluoro-3-methoxysulfanylpropan-2-yl]phosphane |
| SMILES | COSC(F)(F)C(F)(P)C(F)(F)SOc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H20F5O2PS2/c1-22-25-15(18,19)14(17,24)16(20,21)26-23-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h7-11H,2-6,24H2,1H3 |
| InChIKey | DAMPNIXXQRWHRI-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|