C28H41F5NOPS3 — CID 167045064
1,3,5-tricyclohexyl-2-[1,1,2,3,3-pentafluoro-3-(methylsulfanylamino)sulfanyl-2-phosphanylpropyl]sulfanyloxybenzene (PubChem CID 167045064) has the molecular formula C28H41F5NOPS3 and a molecular weight of 629.81 g/mol. Its IUPAC name is 1,3,5-tricyclohexyl-2-[1,1,2,3,3-pentafluoro-3-(methylsulfanylamino)sulfanyl-2-phosphanylpropyl]sulfanyloxybenzene.
| Compound Name | 1,3,5-tricyclohexyl-2-[1,1,2,3,3-pentafluoro-3-(methylsulfanylamino)sulfanyl-2-phosphanylpropyl]sulfanyloxybenzene |
|---|---|
| PubChem CID | 167045064 |
| Molecular Formula | C28H41F5NOPS3 |
| Molecular Weight | 629.81 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | 1,3,5-tricyclohexyl-2-[1,1,2,3,3-pentafluoro-3-(methylsulfanylamino)sulfanyl-2-phosphanylpropyl]sulfanyloxybenzene |
| SMILES | CSNSC(F)(F)C(F)(P)C(F)(F)SOc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C28H41F5NOPS3/c1-37-34-38-27(30,31)26(29,36)28(32,33)39-35-25-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(25)21-15-9-4-10-16-21/h17-21,34H,2-16,36H2,1H3 |
| InChIKey | NCMKSQIZMOQADU-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.81 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|