C25H39FO2S2 — CID 144690751
1,5-dicyclohexyl-2-[fluoro(hydroxysulfanyl)methyl]sulfanyloxy-3-hexan-3-ylbenzene (PubChem CID 144690751) has the molecular formula C25H39FO2S2 and a molecular weight of 454.72 g/mol. Its IUPAC name is 1,5-dicyclohexyl-2-[fluoro(hydroxysulfanyl)methyl]sulfanyloxy-3-hexan-3-ylbenzene.
| Compound Name | 1,5-dicyclohexyl-2-[fluoro(hydroxysulfanyl)methyl]sulfanyloxy-3-hexan-3-ylbenzene |
|---|---|
| PubChem CID | 144690751 |
| Molecular Formula | C25H39FO2S2 |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 1,5-dicyclohexyl-2-[fluoro(hydroxysulfanyl)methyl]sulfanyloxy-3-hexan-3-ylbenzene |
| SMILES | CCCC(CC)c1cc(C2CCCCC2)cc(C2CCCCC2)c1OSC(F)SO |
| InChI | InChI=1S/C25H39FO2S2/c1-3-11-18(4-2)22-16-21(19-12-7-5-8-13-19)17-23(20-14-9-6-10-15-20)24(22)28-30-25(26)29-27/h16-20,25,27H,3-15H2,1-2H3 |
| InChIKey | QFSODVZFHAKOOI-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|