C40H52O2S — CID 158568993
butanoate;diphenyl-(2,4,6-tricyclohexylphenyl)sulfanium (PubChem CID 158568993) has the molecular formula C40H52O2S and a molecular weight of 596.92 g/mol. Its IUPAC name is butanoate;diphenyl-(2,4,6-tricyclohexylphenyl)sulfanium.
| Compound Name | butanoate;diphenyl-(2,4,6-tricyclohexylphenyl)sulfanium |
|---|---|
| PubChem CID | 158568993 |
| Molecular Formula | C40H52O2S |
| Molecular Weight | 596.92 g/mol |
| Exact Mass | 596.37 |
| IUPAC Name | butanoate;diphenyl-(2,4,6-tricyclohexylphenyl)sulfanium |
| SMILES | CCCC(=O)[O-].c1ccc([S+](c2ccccc2)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)cc1 |
| InChI | InChI=1S/C36H45S.C4H8O2/c1-6-16-28(17-7-1)31-26-34(29-18-8-2-9-19-29)36(35(27-31)30-20-10-3-11-21-30)37(32-22-12-4-13-23-32)33-24-14-5-15-25-33;1-2-3-4(5)6/h4-5,12-15,22-30H,1-3,6-11,16-21H2;2-3H2,1H3,(H,5,6)/q+1;/p-1 |
| InChIKey | HRVRDOKFAWIDMK-UHFFFAOYSA-M |
| XLogP | 10.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.92 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|