C29H42F2O2S2 — CID 144554433
buta-1,3-diene;1,3,5-tricyclohexyl-2-[difluoro(hydroxysulfanyl)methyl]sulfanyloxybenzene (PubChem CID 144554433) has the molecular formula C29H42F2O2S2 and a molecular weight of 524.78 g/mol. Its IUPAC name is buta-1,3-diene;1,3,5-tricyclohexyl-2-[difluoro(hydroxysulfanyl)methyl]sulfanyloxybenzene.
| Compound Name | buta-1,3-diene;1,3,5-tricyclohexyl-2-[difluoro(hydroxysulfanyl)methyl]sulfanyloxybenzene |
|---|---|
| PubChem CID | 144554433 |
| Molecular Formula | C29H42F2O2S2 |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | buta-1,3-diene;1,3,5-tricyclohexyl-2-[difluoro(hydroxysulfanyl)methyl]sulfanyloxybenzene |
| SMILES | C=CC=C.OSC(F)(F)SOc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C25H36F2O2S2.C4H6/c26-25(27,30-28)31-29-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;1-3-4-2/h16-20,28H,1-15H2;3-4H,1-2H2 |
| InChIKey | BXJJXQQLNKZLNN-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|