C18H28ClNO — CID 139812454
2-amino-4,6-dicyclohexylphenol;hydrochloride (PubChem CID 139812454) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is 2-amino-4,6-dicyclohexylphenol;hydrochloride.
| Compound Name | 2-amino-4,6-dicyclohexylphenol;hydrochloride |
|---|---|
| PubChem CID | 139812454 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-amino-4,6-dicyclohexylphenol;hydrochloride |
| SMILES | Cl.Nc1cc(C2CCCCC2)cc(C2CCCCC2)c1O |
| InChI | InChI=1S/C18H27NO.ClH/c19-17-12-15(13-7-3-1-4-8-13)11-16(18(17)20)14-9-5-2-6-10-14;/h11-14,20H,1-10,19H2;1H |
| InChIKey | RWFIYYSKUQDXLP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|