C12H18N2O — CID 12501819
2,6-diamino-4-cyclohexylphenol (PubChem CID 12501819) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2,6-diamino-4-cyclohexylphenol.
| Compound Name | 2,6-diamino-4-cyclohexylphenol |
|---|---|
| PubChem CID | 12501819 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2,6-diamino-4-cyclohexylphenol |
| SMILES | Nc1cc(C2CCCCC2)cc(N)c1O |
| InChI | InChI=1S/C12H18N2O/c13-10-6-9(7-11(14)12(10)15)8-4-2-1-3-5-8/h6-8,15H,1-5,13-14H2 |
| InChIKey | ALGFXEQKXDGWJR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|