C28H36F9NO5S2 — CID 121355107
(2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylamino)propane-1-sulfonate (PubChem CID 121355107) has the molecular formula C28H36F9NO5S2 and a molecular weight of 701.71 g/mol. Its IUPAC name is (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylamino)propane-1-sulfonate.
| Compound Name | (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 121355107 |
| Molecular Formula | C28H36F9NO5S2 |
| Molecular Weight | 701.71 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | (2,4,6-tricyclohexylphenyl) 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylamino)propane-1-sulfonate |
| SMILES | O=S(=O)(NC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C28H36F9NO5S2/c29-25(30,26(31,32)38-44(39,40)28(35,36)37)27(33,34)45(41,42)43-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20/h16-20,38H,1-15H2 |
| InChIKey | ROGQBMQOUBCULO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.71 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|