C30H37F4O4S+ — CID 140868248
[2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)phenyl]sulfonyloxidanium (PubChem CID 140868248) has the molecular formula C30H37F4O4S+ and a molecular weight of 569.68 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)phenyl]sulfonyloxidanium.
| Compound Name | [2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)phenyl]sulfonyloxidanium |
|---|---|
| PubChem CID | 140868248 |
| Molecular Formula | C30H37F4O4S+ |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.23 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)phenyl]sulfonyloxidanium |
| SMILES | O=S(=O)([OH2+])c1c(F)c(F)c(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C30H36F4O4S/c31-24-26(33)30(39(35,36)37)27(34)25(32)29(24)38-28-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(28)20-14-8-3-9-15-20/h16-20H,1-15H2,(H,35,36,37)/p+1 |
| InChIKey | IJJAJTOQVWBJNR-UHFFFAOYSA-O |
| XLogP | 8.59 |
| TPSA | 66.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|