C36H49O4S- — CID 58341661
2,6-dicyclohexyl-4-(3,5-dicyclohexylphenoxy)benzenesulfonate (PubChem CID 58341661) has the molecular formula C36H49O4S- and a molecular weight of 577.85 g/mol. Its IUPAC name is 2,6-dicyclohexyl-4-(3,5-dicyclohexylphenoxy)benzenesulfonate.
| Compound Name | 2,6-dicyclohexyl-4-(3,5-dicyclohexylphenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 58341661 |
| Molecular Formula | C36H49O4S- |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | 2,6-dicyclohexyl-4-(3,5-dicyclohexylphenoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(C2CCCCC2)cc(Oc2cc(C3CCCCC3)cc(C3CCCCC3)c2)cc1C1CCCCC1 |
| InChI | InChI=1S/C36H50O4S/c37-41(38,39)36-34(28-17-9-3-10-18-28)24-33(25-35(36)29-19-11-4-12-20-29)40-32-22-30(26-13-5-1-6-14-26)21-31(23-32)27-15-7-2-8-16-27/h21-29H,1-20H2,(H,37,38,39)/p-1 |
| InChIKey | QMKTVGFOWUJVLE-UHFFFAOYSA-M |
| XLogP | 10.57 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|