C18H25O4S- — CID 58341632
2,6-dicyclohexyl-4-hydroxybenzenesulfonate (PubChem CID 58341632) has the molecular formula C18H25O4S- and a molecular weight of 337.46 g/mol. Its IUPAC name is 2,6-dicyclohexyl-4-hydroxybenzenesulfonate.
| Compound Name | 2,6-dicyclohexyl-4-hydroxybenzenesulfonate |
|---|---|
| PubChem CID | 58341632 |
| Molecular Formula | C18H25O4S- |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2,6-dicyclohexyl-4-hydroxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(C2CCCCC2)cc(O)cc1C1CCCCC1 |
| InChI | InChI=1S/C18H26O4S/c19-15-11-16(13-7-3-1-4-8-13)18(23(20,21)22)17(12-15)14-9-5-2-6-10-14/h11-14,19H,1-10H2,(H,20,21,22)/p-1 |
| InChIKey | ZMUMBQLHUUWVRZ-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|