C32H37F6O6S2- — CID 176603807
3-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,6-bis(trifluoromethyl)benzenesulfonate (PubChem CID 176603807) has the molecular formula C32H37F6O6S2- and a molecular weight of 695.76 g/mol. Its IUPAC name is 3-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,6-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | 3-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,6-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 176603807 |
| Molecular Formula | C32H37F6O6S2- |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 695.19 |
| IUPAC Name | 3-(2,4,6-tricyclohexylphenyl)sulfonyloxy-2,6-bis(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(C(F)(F)F)ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c1C(F)(F)F |
| InChI | InChI=1S/C32H38F6O6S2/c33-31(34,35)26-16-17-27(28(32(36,37)38)30(26)45(39,40)41)44-46(42,43)29-24(21-12-6-2-7-13-21)18-23(20-10-4-1-5-11-20)19-25(29)22-14-8-3-9-15-22/h16-22H,1-15H2,(H,39,40,41)/p-1 |
| InChIKey | MZELOMVDDQLSAZ-UHFFFAOYSA-M |
| XLogP | 9.54 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|