C31H39F3O6S3 — CID 176603695
4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonic acid (PubChem CID 176603695) has the molecular formula C31H39F3O6S3 and a molecular weight of 660.84 g/mol. Its IUPAC name is 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonic acid.
| Compound Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 176603695 |
| Molecular Formula | C31H39F3O6S3 |
| Molecular Weight | 660.84 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(SC(F)(F)F)c1 |
| InChI | InChI=1S/C31H39F3O6S3/c32-31(33,34)41-29-20-25(42(35,36)37)16-17-28(29)40-43(38,39)30-26(22-12-6-2-7-13-22)18-24(21-10-4-1-5-11-21)19-27(30)23-14-8-3-9-15-23/h16-23H,1-15H2,(H,35,36,37) |
| InChIKey | YHVNHZXEUOTAAQ-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.84 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|