C36H49O7S2- — CID 58341657
2,6-dicyclohexyl-4-(3,5-dicyclohexyl-4-sulfophenoxy)benzenesulfonate (PubChem CID 58341657) has the molecular formula C36H49O7S2- and a molecular weight of 657.92 g/mol. Its IUPAC name is 2,6-dicyclohexyl-4-(3,5-dicyclohexyl-4-sulfophenoxy)benzenesulfonate.
| Compound Name | 2,6-dicyclohexyl-4-(3,5-dicyclohexyl-4-sulfophenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 58341657 |
| Molecular Formula | C36H49O7S2- |
| Molecular Weight | 657.92 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | 2,6-dicyclohexyl-4-(3,5-dicyclohexyl-4-sulfophenoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(C2CCCCC2)cc(Oc2cc(C3CCCCC3)c(S(=O)(=O)O)c(C3CCCCC3)c2)cc1C1CCCCC1 |
| InChI | InChI=1S/C36H50O7S2/c37-44(38,39)35-31(25-13-5-1-6-14-25)21-29(22-32(35)26-15-7-2-8-16-26)43-30-23-33(27-17-9-3-10-18-27)36(45(40,41)42)34(24-30)28-19-11-4-12-20-28/h21-28H,1-20H2,(H,37,38,39)(H,40,41,42)/p-1 |
| InChIKey | KYYWCBDYSIVTCJ-UHFFFAOYSA-M |
| XLogP | 9.82 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.92 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|