C29H31F3O7S2 — CID 177111573
2-cyclohexyl-4-[7-(1-methoxy-2-methylpropoxy)-6-(trifluoromethylsulfanyl)naphthalene-2-carbonyl]oxybenzenesulfonic acid (PubChem CID 177111573) has the molecular formula C29H31F3O7S2 and a molecular weight of 612.69 g/mol. Its IUPAC name is 2-cyclohexyl-4-[7-(1-methoxy-2-methylpropoxy)-6-(trifluoromethylsulfanyl)naphthalene-2-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2-cyclohexyl-4-[7-(1-methoxy-2-methylpropoxy)-6-(trifluoromethylsulfanyl)naphthalene-2-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 177111573 |
| Molecular Formula | C29H31F3O7S2 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | 2-cyclohexyl-4-[7-(1-methoxy-2-methylpropoxy)-6-(trifluoromethylsulfanyl)naphthalene-2-carbonyl]oxybenzenesulfonic acid |
| SMILES | COC(Oc1cc2cc(C(=O)Oc3ccc(S(=O)(=O)O)c(C4CCCCC4)c3)ccc2cc1SC(F)(F)F)C(C)C |
| InChI | InChI=1S/C29H31F3O7S2/c1-17(2)28(37-3)39-24-14-21-13-20(10-9-19(21)15-25(24)40-29(30,31)32)27(33)38-22-11-12-26(41(34,35)36)23(16-22)18-7-5-4-6-8-18/h9-18,28H,4-8H2,1-3H3,(H,34,35,36) |
| InChIKey | OXSNSJFCMPWOGE-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|