C19H16I4O5S — CID 170531251
2-cyclohexyl-4-(2,3,4,5-tetraiodobenzoyl)oxybenzenesulfonic acid (PubChem CID 170531251) has the molecular formula C19H16I4O5S and a molecular weight of 864.01 g/mol. Its IUPAC name is 2-cyclohexyl-4-(2,3,4,5-tetraiodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2-cyclohexyl-4-(2,3,4,5-tetraiodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531251 |
| Molecular Formula | C19H16I4O5S |
| Molecular Weight | 864.01 g/mol |
| Exact Mass | 863.69 |
| IUPAC Name | 2-cyclohexyl-4-(2,3,4,5-tetraiodobenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1ccc(S(=O)(=O)O)c(C2CCCCC2)c1)c1cc(I)c(I)c(I)c1I |
| InChI | InChI=1S/C19H16I4O5S/c20-14-9-13(16(21)18(23)17(14)22)19(24)28-11-6-7-15(29(25,26)27)12(8-11)10-4-2-1-3-5-10/h6-10H,1-5H2,(H,25,26,27) |
| InChIKey | AOKVGKHYYVJPHW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.01 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|