C23H22I2O5S — CID 170531371
2-(2-adamantyl)-4-(2,3-diiodobenzoyl)oxybenzenesulfonic acid (PubChem CID 170531371) has the molecular formula C23H22I2O5S and a molecular weight of 664.30 g/mol. Its IUPAC name is 2-(2-adamantyl)-4-(2,3-diiodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2-(2-adamantyl)-4-(2,3-diiodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531371 |
| Molecular Formula | C23H22I2O5S |
| Molecular Weight | 664.30 g/mol |
| Exact Mass | 663.93 |
| IUPAC Name | 2-(2-adamantyl)-4-(2,3-diiodobenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1ccc(S(=O)(=O)O)c(C2C3CC4CC(C3)CC2C4)c1)c1cccc(I)c1I |
| InChI | InChI=1S/C23H22I2O5S/c24-19-3-1-2-17(22(19)25)23(26)30-16-4-5-20(31(27,28)29)18(11-16)21-14-7-12-6-13(9-14)10-15(21)8-12/h1-5,11-15,21H,6-10H2,(H,27,28,29) |
| InChIKey | JXLZTEAXKFZEJB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.30 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|