C23H21I3O5S — CID 176623792
2-(2-adamantyl)-4-(2,3,6-triiodophenoxy)carbonylbenzenesulfonic acid (PubChem CID 176623792) has the molecular formula C23H21I3O5S and a molecular weight of 790.19 g/mol. Its IUPAC name is 2-(2-adamantyl)-4-(2,3,6-triiodophenoxy)carbonylbenzenesulfonic acid.
| Compound Name | 2-(2-adamantyl)-4-(2,3,6-triiodophenoxy)carbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 176623792 |
| Molecular Formula | C23H21I3O5S |
| Molecular Weight | 790.19 g/mol |
| Exact Mass | 789.82 |
| IUPAC Name | 2-(2-adamantyl)-4-(2,3,6-triiodophenoxy)carbonylbenzenesulfonic acid |
| SMILES | O=C(Oc1c(I)ccc(I)c1I)c1ccc(S(=O)(=O)O)c(C2C3CC4CC(C3)CC2C4)c1 |
| InChI | InChI=1S/C23H21I3O5S/c24-17-2-3-18(25)22(21(17)26)31-23(27)13-1-4-19(32(28,29)30)16(10-13)20-14-6-11-5-12(8-14)9-15(20)7-11/h1-4,10-12,14-15,20H,5-9H2,(H,28,29,30) |
| InChIKey | YSYAWRNKWDDPOJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.19 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|