C19H18IO5S- — CID 176623674
2-cyclohexyl-4-(2-iodophenoxy)carbonylbenzenesulfonate (PubChem CID 176623674) has the molecular formula C19H18IO5S- and a molecular weight of 485.32 g/mol. Its IUPAC name is 2-cyclohexyl-4-(2-iodophenoxy)carbonylbenzenesulfonate.
| Compound Name | 2-cyclohexyl-4-(2-iodophenoxy)carbonylbenzenesulfonate |
|---|---|
| PubChem CID | 176623674 |
| Molecular Formula | C19H18IO5S- |
| Molecular Weight | 485.32 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | 2-cyclohexyl-4-(2-iodophenoxy)carbonylbenzenesulfonate |
| SMILES | O=C(Oc1ccccc1I)c1ccc(S(=O)(=O)[O-])c(C2CCCCC2)c1 |
| InChI | InChI=1S/C19H19IO5S/c20-16-8-4-5-9-17(16)25-19(21)14-10-11-18(26(22,23)24)15(12-14)13-6-2-1-3-7-13/h4-5,8-13H,1-3,6-7H2,(H,22,23,24)/p-1 |
| InChIKey | QLVFNXLJJFQKAK-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|