C21H25NO6S — CID 8778455
(2-methoxyphenyl) 4-methoxy-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 8778455) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2-methoxyphenyl) 4-methoxy-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | (2-methoxyphenyl) 4-methoxy-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8778455 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2-methoxyphenyl) 4-methoxy-3-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | COc1ccccc1OC(=O)c1ccc(OC)c(S(=O)(=O)N2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C21H25NO6S/c1-15-8-6-7-13-22(15)29(24,25)20-14-16(11-12-19(20)27-3)21(23)28-18-10-5-4-9-17(18)26-2/h4-5,9-12,14-15H,6-8,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | YMONMSYVMLOSCD-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|