C20H22N2O7S — CID 42996325
(4-nitrophenyl) 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 42996325) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is (4-nitrophenyl) 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (4-nitrophenyl) 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42996325 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (4-nitrophenyl) 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc([N+](=O)[O-])cc2)cc1S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C20H22N2O7S/c1-14-5-3-4-12-21(14)30(26,27)19-13-15(6-11-18(19)28-2)20(23)29-17-9-7-16(8-10-17)22(24)25/h6-11,13-14H,3-5,12H2,1-2H3 |
| InChIKey | YSJXOOVIKHJPBA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|