C21H23NO7S — CID 5013104
1,3-benzodioxol-5-yl 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 5013104) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 5013104 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc3c(c2)OCO3)cc1S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C21H23NO7S/c1-14-5-3-4-10-22(14)30(24,25)20-11-15(6-8-18(20)26-2)21(23)29-16-7-9-17-19(12-16)28-13-27-17/h6-9,11-12,14H,3-5,10,13H2,1-2H3 |
| InChIKey | GBDKKRZIBDLHBP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|