C22H28N2O6S — CID 46651292
N-(3,5-dimethoxyphenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 46651292) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 46651292 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(OC)c(S(=O)(=O)N3CCCCC3C)c2)cc(OC)c1 |
| InChI | InChI=1S/C22H28N2O6S/c1-15-7-5-6-10-24(15)31(26,27)21-11-16(8-9-20(21)30-4)22(25)23-17-12-18(28-2)14-19(13-17)29-3/h8-9,11-15H,5-7,10H2,1-4H3,(H,23,25) |
| InChIKey | WZENBADOVPPLIB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |