C20H22ClFN2O4S — CID 43009763
N-(2-chloro-4-fluorophenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 43009763) has the molecular formula C20H22ClFN2O4S and a molecular weight of 440.92 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 43009763 |
| Molecular Formula | C20H22ClFN2O4S |
| Molecular Weight | 440.92 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(F)cc2Cl)cc1S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C20H22ClFN2O4S/c1-13-5-3-4-10-24(13)29(26,27)19-11-14(6-9-18(19)28-2)20(25)23-17-8-7-15(22)12-16(17)21/h6-9,11-13H,3-5,10H2,1-2H3,(H,23,25) |
| InChIKey | CKGVVFABNPCDQU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |