C22H29N3O6S2 — CID 24685961
N-[3-(dimethylsulfamoyl)phenyl]-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 24685961) has the molecular formula C22H29N3O6S2 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 24685961 |
| Molecular Formula | C22H29N3O6S2 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-4-methoxy-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)cc1S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C22H29N3O6S2/c1-16-8-5-6-13-25(16)33(29,30)21-14-17(11-12-20(21)31-4)22(26)23-18-9-7-10-19(15-18)32(27,28)24(2)3/h7,9-12,14-16H,5-6,8,13H2,1-4H3,(H,23,26) |
| InChIKey | OBVQQXJNTHXMOW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |