C20H23NO5S — CID 7984818
phenyl 4-methoxy-3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7984818) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is phenyl 4-methoxy-3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | phenyl 4-methoxy-3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7984818 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | phenyl 4-methoxy-3-[(2S)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2)cc1S(=O)(=O)N1CCCC[C@@H]1C |
| InChI | InChI=1S/C20H23NO5S/c1-15-8-6-7-13-21(15)27(23,24)19-14-16(11-12-18(19)25-2)20(22)26-17-9-4-3-5-10-17/h3-5,9-12,14-15H,6-8,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | UWAGGZKGHQRWOG-HNNXBMFYSA-N |
| XLogP | 3.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|