C19H19IO5S — CID 170531187
2-cyclohexyl-4-(2-iodobenzoyl)oxybenzenesulfonic acid (PubChem CID 170531187) has the molecular formula C19H19IO5S and a molecular weight of 486.33 g/mol. Its IUPAC name is 2-cyclohexyl-4-(2-iodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 2-cyclohexyl-4-(2-iodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531187 |
| Molecular Formula | C19H19IO5S |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 2-cyclohexyl-4-(2-iodobenzoyl)oxybenzenesulfonic acid |
| SMILES | O=C(Oc1ccc(S(=O)(=O)O)c(C2CCCCC2)c1)c1ccccc1I |
| InChI | InChI=1S/C19H19IO5S/c20-17-9-5-4-8-15(17)19(21)25-14-10-11-18(26(22,23)24)16(12-14)13-6-2-1-3-7-13/h4-5,8-13H,1-3,6-7H2,(H,22,23,24) |
| InChIKey | PZBOOYACNJBPTB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|