C28H26I2O9S — CID 170531045
2-cyclohexyl-4-[2-(3,4-diiodobenzoyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid (PubChem CID 170531045) has the molecular formula C28H26I2O9S and a molecular weight of 792.38 g/mol. Its IUPAC name is 2-cyclohexyl-4-[2-(3,4-diiodobenzoyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2-cyclohexyl-4-[2-(3,4-diiodobenzoyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531045 |
| Molecular Formula | C28H26I2O9S |
| Molecular Weight | 792.38 g/mol |
| Exact Mass | 791.94 |
| IUPAC Name | 2-cyclohexyl-4-[2-(3,4-diiodobenzoyl)oxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid |
| SMILES | O=C(OC1C2CC3C1OC(=O)C3C2C(=O)Oc1ccc(S(=O)(=O)O)c(C2CCCCC2)c1)c1ccc(I)c(I)c1 |
| InChI | InChI=1S/C28H26I2O9S/c29-19-8-6-14(10-20(19)30)26(31)38-24-17-12-18-23(28(33)39-25(18)24)22(17)27(32)37-15-7-9-21(40(34,35)36)16(11-15)13-4-2-1-3-5-13/h6-11,13,17-18,22-25H,1-5,12H2,(H,34,35,36) |
| InChIKey | MHUQOCWBOBMGSV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|