C27H23I3O9S2 — CID 170531265
2-cyclohexyl-4-[5-oxo-2-(2,3,5-triiodobenzoyl)oxy-4-oxa-8-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid (PubChem CID 170531265) has the molecular formula C27H23I3O9S2 and a molecular weight of 936.32 g/mol. Its IUPAC name is 2-cyclohexyl-4-[5-oxo-2-(2,3,5-triiodobenzoyl)oxy-4-oxa-8-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 2-cyclohexyl-4-[5-oxo-2-(2,3,5-triiodobenzoyl)oxy-4-oxa-8-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531265 |
| Molecular Formula | C27H23I3O9S2 |
| Molecular Weight | 936.32 g/mol |
| Exact Mass | 935.79 |
| IUPAC Name | 2-cyclohexyl-4-[5-oxo-2-(2,3,5-triiodobenzoyl)oxy-4-oxa-8-thiatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxybenzenesulfonic acid |
| SMILES | O=C(OC1C2OC(=O)C3C2SC1C3C(=O)Oc1ccc(S(=O)(=O)O)c(C2CCCCC2)c1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C27H23I3O9S2/c28-12-8-15(20(30)16(29)9-12)25(31)38-21-22-24-19(27(33)39-22)18(23(21)40-24)26(32)37-13-6-7-17(41(34,35)36)14(10-13)11-4-2-1-3-5-11/h6-11,18-19,21-24H,1-5H2,(H,34,35,36) |
| InChIKey | UMNNHLHFWHBZSW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.32 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|