C31H38F3O6S3- — CID 176603694
4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonate (PubChem CID 176603694) has the molecular formula C31H38F3O6S3- and a molecular weight of 659.83 g/mol. Its IUPAC name is 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonate.
| Compound Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonate |
|---|---|
| PubChem CID | 176603694 |
| Molecular Formula | C31H38F3O6S3- |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.18 |
| IUPAC Name | 4-(2,4,6-tricyclohexylphenyl)sulfonyloxy-3-(trifluoromethylsulfanyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OS(=O)(=O)c2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(SC(F)(F)F)c1 |
| InChI | InChI=1S/C31H39F3O6S3/c32-31(33,34)41-29-20-25(42(35,36)37)16-17-28(29)40-43(38,39)30-26(22-12-6-2-7-13-22)18-24(21-10-4-1-5-11-21)19-27(30)23-14-8-3-9-15-23/h16-23H,1-15H2,(H,35,36,37)/p-1 |
| InChIKey | YHVNHZXEUOTAAQ-UHFFFAOYSA-M |
| XLogP | 9.11 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|