C27H37F2O5S- — CID 154615088
1,1-difluoro-2-(2,4,6-tricyclohexylbenzoyl)oxyethanesulfonate (PubChem CID 154615088) has the molecular formula C27H37F2O5S- and a molecular weight of 511.65 g/mol. Its IUPAC name is 1,1-difluoro-2-(2,4,6-tricyclohexylbenzoyl)oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-(2,4,6-tricyclohexylbenzoyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 154615088 |
| Molecular Formula | C27H37F2O5S- |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 1,1-difluoro-2-(2,4,6-tricyclohexylbenzoyl)oxyethanesulfonate |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[O-])c1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C27H38F2O5S/c28-27(29,35(31,32)33)18-34-26(30)25-23(20-12-6-2-7-13-20)16-22(19-10-4-1-5-11-19)17-24(25)21-14-8-3-9-15-21/h16-17,19-21H,1-15,18H2,(H,31,32,33)/p-1 |
| InChIKey | DBLQRGJRXONBSX-UHFFFAOYSA-M |
| XLogP | 7.12 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|