C35H48O5S — CID 130261073
5-methyl-2-propan-2-yl-4-(2,4,6-tricyclohexylbenzoyl)oxybenzenesulfonic acid (PubChem CID 130261073) has the molecular formula C35H48O5S and a molecular weight of 580.83 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-4-(2,4,6-tricyclohexylbenzoyl)oxybenzenesulfonic acid.
| Compound Name | 5-methyl-2-propan-2-yl-4-(2,4,6-tricyclohexylbenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 130261073 |
| Molecular Formula | C35H48O5S |
| Molecular Weight | 580.83 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 5-methyl-2-propan-2-yl-4-(2,4,6-tricyclohexylbenzoyl)oxybenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C(C)C)cc1OC(=O)c1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C35H48O5S/c1-23(2)29-22-32(24(3)19-33(29)41(37,38)39)40-35(36)34-30(26-15-9-5-10-16-26)20-28(25-13-7-4-8-14-25)21-31(34)27-17-11-6-12-18-27/h19-23,25-27H,4-18H2,1-3H3,(H,37,38,39) |
| InChIKey | WIVDBXNZKQBQMA-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.83 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|