C17H13I5O5S — CID 170531373
5-methyl-4-(2,3,4,5,6-pentaiodobenzoyl)oxy-2-propan-2-ylbenzenesulfonic acid (PubChem CID 170531373) has the molecular formula C17H13I5O5S and a molecular weight of 963.87 g/mol. Its IUPAC name is 5-methyl-4-(2,3,4,5,6-pentaiodobenzoyl)oxy-2-propan-2-ylbenzenesulfonic acid.
| Compound Name | 5-methyl-4-(2,3,4,5,6-pentaiodobenzoyl)oxy-2-propan-2-ylbenzenesulfonic acid |
|---|---|
| PubChem CID | 170531373 |
| Molecular Formula | C17H13I5O5S |
| Molecular Weight | 963.87 g/mol |
| Exact Mass | 963.57 |
| IUPAC Name | 5-methyl-4-(2,3,4,5,6-pentaiodobenzoyl)oxy-2-propan-2-ylbenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C(C)C)cc1OC(=O)c1c(I)c(I)c(I)c(I)c1I |
| InChI | InChI=1S/C17H13I5O5S/c1-6(2)8-5-9(7(3)4-10(8)28(24,25)26)27-17(23)11-12(18)14(20)16(22)15(21)13(11)19/h4-6H,1-3H3,(H,24,25,26) |
| InChIKey | MMZUZSZHUAQMRN-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.87 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|