C27H38O5S — CID 170530100
4-(3,5-ditert-butylbenzoyl)oxy-2,5-di(propan-2-yl)benzenesulfonic acid (PubChem CID 170530100) has the molecular formula C27H38O5S and a molecular weight of 474.66 g/mol. Its IUPAC name is 4-(3,5-ditert-butylbenzoyl)oxy-2,5-di(propan-2-yl)benzenesulfonic acid.
| Compound Name | 4-(3,5-ditert-butylbenzoyl)oxy-2,5-di(propan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 170530100 |
| Molecular Formula | C27H38O5S |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-(3,5-ditert-butylbenzoyl)oxy-2,5-di(propan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)c1cc(S(=O)(=O)O)c(C(C)C)cc1OC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H38O5S/c1-16(2)21-15-24(33(29,30)31)22(17(3)4)14-23(21)32-25(28)18-11-19(26(5,6)7)13-20(12-18)27(8,9)10/h11-17H,1-10H3,(H,29,30,31) |
| InChIKey | BEPUKZNNUCCCGC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|