C25H30O5S — CID 134239658
4-[4-(cyclohexen-1-yl)benzoyl]oxy-2,5-di(propan-2-yl)benzenesulfonic acid (PubChem CID 134239658) has the molecular formula C25H30O5S and a molecular weight of 442.58 g/mol. Its IUPAC name is 4-[4-(cyclohexen-1-yl)benzoyl]oxy-2,5-di(propan-2-yl)benzenesulfonic acid.
| Compound Name | 4-[4-(cyclohexen-1-yl)benzoyl]oxy-2,5-di(propan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 134239658 |
| Molecular Formula | C25H30O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-[4-(cyclohexen-1-yl)benzoyl]oxy-2,5-di(propan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)c1cc(S(=O)(=O)O)c(C(C)C)cc1OC(=O)c1ccc(C2=CCCCC2)cc1 |
| InChI | InChI=1S/C25H30O5S/c1-16(2)21-15-24(31(27,28)29)22(17(3)4)14-23(21)30-25(26)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h8,10-17H,5-7,9H2,1-4H3,(H,27,28,29) |
| InChIKey | MSRRCKHYAXIXGF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|