C17H15I3O5S — CID 170531041
5-methyl-2-propan-2-yl-4-(2,3,4-triiodobenzoyl)oxybenzenesulfonic acid (PubChem CID 170531041) has the molecular formula C17H15I3O5S and a molecular weight of 712.08 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yl-4-(2,3,4-triiodobenzoyl)oxybenzenesulfonic acid.
| Compound Name | 5-methyl-2-propan-2-yl-4-(2,3,4-triiodobenzoyl)oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 170531041 |
| Molecular Formula | C17H15I3O5S |
| Molecular Weight | 712.08 g/mol |
| Exact Mass | 711.78 |
| IUPAC Name | 5-methyl-2-propan-2-yl-4-(2,3,4-triiodobenzoyl)oxybenzenesulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c(C(C)C)cc1OC(=O)c1ccc(I)c(I)c1I |
| InChI | InChI=1S/C17H15I3O5S/c1-8(2)11-7-13(9(3)6-14(11)26(22,23)24)25-17(21)10-4-5-12(18)16(20)15(10)19/h4-8H,1-3H3,(H,22,23,24) |
| InChIKey | GCZHHXJJJLIGJU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.08 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|