C27H40F5NO7S3 — CID 162594559
(2,4,6-tricyclohexylphenyl) difluoro-[[hydroxy-methyl-oxo-(trifluoromethyl)-λ6-sulfanyl]sulfamoyl]methanesulfonate (PubChem CID 162594559) has the molecular formula C27H40F5NO7S3 and a molecular weight of 681.81 g/mol. Its IUPAC name is (2,4,6-tricyclohexylphenyl) difluoro-[[hydroxy-methyl-oxo-(trifluoromethyl)-λ6-sulfanyl]sulfamoyl]methanesulfonate.
| Compound Name | (2,4,6-tricyclohexylphenyl) difluoro-[[hydroxy-methyl-oxo-(trifluoromethyl)-λ6-sulfanyl]sulfamoyl]methanesulfonate |
|---|---|
| PubChem CID | 162594559 |
| Molecular Formula | C27H40F5NO7S3 |
| Molecular Weight | 681.81 g/mol |
| Exact Mass | 681.19 |
| IUPAC Name | (2,4,6-tricyclohexylphenyl) difluoro-[[hydroxy-methyl-oxo-(trifluoromethyl)-λ6-sulfanyl]sulfamoyl]methanesulfonate |
| SMILES | CS(=O)(O)(NS(=O)(=O)C(F)(F)S(=O)(=O)Oc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C27H40F5NO7S3/c1-43(38,39,26(28,29)30)33-41(34,35)27(31,32)42(36,37)40-25-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(25)21-15-9-4-10-16-21/h17-21H,2-16H2,1H3,(H2,33,38,39) |
| InChIKey | IQMJESAAEMSIDT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.81 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|