C31H37F4O4S- — CID 163517547
methanidyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate (PubChem CID 163517547) has the molecular formula C31H37F4O4S- and a molecular weight of 581.69 g/mol. Its IUPAC name is methanidyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate.
| Compound Name | methanidyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
|---|---|
| PubChem CID | 163517547 |
| Molecular Formula | C31H37F4O4S- |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | methanidyl 2,3,5,6-tetrafluoro-4-(2,4,6-tricyclohexylphenoxy)benzenesulfonate |
| SMILES | [CH2-]OS(=O)(=O)c1c(F)c(F)c(Oc2c(C3CCCCC3)cc(C3CCCCC3)cc2C2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C31H37F4O4S/c1-38-40(36,37)31-27(34)25(32)30(26(33)28(31)35)39-29-23(20-13-7-3-8-14-20)17-22(19-11-5-2-6-12-19)18-24(29)21-15-9-4-10-16-21/h17-21H,1-16H2/q-1 |
| InChIKey | DIANMCUDIJUDPW-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|