C18H26O4 — CID 21162802
1,4-dicyclohexyl-2,3-dihydroperoxybenzene (PubChem CID 21162802) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 1,4-dicyclohexyl-2,3-dihydroperoxybenzene.
| Compound Name | 1,4-dicyclohexyl-2,3-dihydroperoxybenzene |
|---|---|
| PubChem CID | 21162802 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1,4-dicyclohexyl-2,3-dihydroperoxybenzene |
| SMILES | OOc1c(C2CCCCC2)ccc(C2CCCCC2)c1OO |
| InChI | InChI=1S/C18H26O4/c19-21-17-15(13-7-3-1-4-8-13)11-12-16(18(17)22-20)14-9-5-2-6-10-14/h11-14,19-20H,1-10H2 |
| InChIKey | DNLGYBANWAEXOH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|