C10H6ClF2IO4 — CID 156523074
3-(4-chloro-3-iodobenzoyl)oxy-2,2-difluoropropanoic acid (PubChem CID 156523074) has the molecular formula C10H6ClF2IO4 and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-(4-chloro-3-iodobenzoyl)oxy-2,2-difluoropropanoic acid.
| Compound Name | 3-(4-chloro-3-iodobenzoyl)oxy-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 156523074 |
| Molecular Formula | C10H6ClF2IO4 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | 3-(4-chloro-3-iodobenzoyl)oxy-2,2-difluoropropanoic acid |
| SMILES | O=C(OCC(F)(F)C(=O)O)c1ccc(Cl)c(I)c1 |
| InChI | InChI=1S/C10H6ClF2IO4/c11-6-2-1-5(3-7(6)14)8(15)18-4-10(12,13)9(16)17/h1-3H,4H2,(H,16,17) |
| InChIKey | HNBIPDWFEHYVLE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|