C15H12Cl2I2O8S — CID 158054837
4-chloro-3-iodobenzoic acid;methyl 4-chloro-3-iodobenzoate;sulfuric acid (PubChem CID 158054837) has the molecular formula C15H12Cl2I2O8S and a molecular weight of 677.03 g/mol. Its IUPAC name is 4-chloro-3-iodobenzoic acid;methyl 4-chloro-3-iodobenzoate;sulfuric acid.
| Compound Name | 4-chloro-3-iodobenzoic acid;methyl 4-chloro-3-iodobenzoate;sulfuric acid |
|---|---|
| PubChem CID | 158054837 |
| Molecular Formula | C15H12Cl2I2O8S |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 675.77 |
| IUPAC Name | 4-chloro-3-iodobenzoic acid;methyl 4-chloro-3-iodobenzoate;sulfuric acid |
| SMILES | COC(=O)c1ccc(Cl)c(I)c1.O=C(O)c1ccc(Cl)c(I)c1.O=S(=O)(O)O |
| InChI | InChI=1S/C8H6ClIO2.C7H4ClIO2.H2O4S/c1-12-8(11)5-2-3-6(9)7(10)4-5;8-5-2-1-4(7(10)11)3-6(5)9;1-5(2,3)4/h2-4H,1H3;1-3H,(H,10,11);(H2,1,2,3,4) |
| InChIKey | ZPUNGKCBPKNOOT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|